About 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid
2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid (PubChem CID 79740284) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid.
Analyze 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid?
The IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid (CID 79740284) is 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid.
What is the SMILES notation for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid?
The canonical SMILES for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid is O=C(O)CC1CCc2cccnc21.
What is the InChIKey of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid?
The InChIKey is KFZXSBFDXRGZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2/c12-9(13)6-8-4-3-7-2-1-5-11-10(7)8/h1-2,5,8H,3-4,6H2,(H,12,13).
What are the key properties of 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid?
2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid has a molecular weight of 177.20 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)acetic acid is sourced from PubChem (CID 79740284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).