C13H19NO — CID 79738601
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)pentan-3-ol (PubChem CID 79738601) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)pentan-3-ol.
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)pentan-3-ol |
|---|---|
| PubChem CID | 79738601 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)pentan-3-ol |
| SMILES | CCC(O)CCC1CCc2cccnc21 |
| InChI | InChI=1S/C13H19NO/c1-2-12(15)8-7-11-6-5-10-4-3-9-14-13(10)11/h3-4,9,11-12,15H,2,5-8H2,1H3 |
| InChIKey | UEIRDIBLLROMQR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |