C11H13N — CID 115410429
7-prop-2-enyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 115410429) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 7-prop-2-enyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | 7-prop-2-enyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 115410429 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 7-prop-2-enyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | C=CCC1CCc2cccnc21 |
| InChI | InChI=1S/C11H13N/c1-2-4-9-6-7-10-5-3-8-12-11(9)10/h2-3,5,8-9H,1,4,6-7H2 |
| InChIKey | FHCLFKVISPNULP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|