C12H14O2 — CID 112546950
2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde (PubChem CID 112546950) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde.
| Compound Name | 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 112546950 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl)acetaldehyde |
| SMILES | O=CCC1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C12H14O2/c13-8-7-10-4-1-3-9-5-2-6-11(14)12(9)10/h2,5-6,8,10,14H,1,3-4,7H2 |
| InChIKey | JTSJXLXLBONJRD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|