C11H15NO — CID 83827745
8-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 83827745) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 8-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 83827745 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8-(aminomethyl)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | NCC1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C11H15NO/c12-7-9-5-1-3-8-4-2-6-10(13)11(8)9/h2,4,6,9,13H,1,3,5,7,12H2 |
| InChIKey | YRAZWRVQNBHMKJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |