C8H9NO — CID 105427855
8-aminobicyclo[4.2.0]octa-1(6),2,4-trien-2-ol (PubChem CID 105427855) has the molecular formula C8H9NO and a molecular weight of 135.17 g/mol. Its IUPAC name is 8-aminobicyclo[4.2.0]octa-1(6),2,4-trien-2-ol.
| Compound Name | 8-aminobicyclo[4.2.0]octa-1(6),2,4-trien-2-ol |
|---|---|
| PubChem CID | 105427855 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 8-aminobicyclo[4.2.0]octa-1(6),2,4-trien-2-ol |
| SMILES | NC1Cc2cccc(O)c21 |
| InChI | InChI=1S/C8H9NO/c9-6-4-5-2-1-3-7(10)8(5)6/h1-3,6,10H,4,9H2 |
| InChIKey | HSYWYPSOVMIFTM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|