C11H12O3 — CID 156582450
(1R,9S,10S)-10-methyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-ol (PubChem CID 156582450) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1R,9S,10S)-10-methyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-ol.
| Compound Name | (1R,9S,10S)-10-methyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-ol |
|---|---|
| PubChem CID | 156582450 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (1R,9S,10S)-10-methyl-11,12-dioxatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-ol |
| SMILES | C[C@@H]1O[C@@H]2O[C@H]1Cc1cccc(O)c12 |
| InChI | InChI=1S/C11H12O3/c1-6-9-5-7-3-2-4-8(12)10(7)11(13-6)14-9/h2-4,6,9,11-12H,5H2,1H3/t6-,9-,11+/m0/s1 |
| InChIKey | ZJSWNJFOIQAGEG-DQBIJJQNSA-N |
| XLogP | 1.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |