C11H14O2 — CID 115010745
8-methyl-5,6,7,8-tetrahydronaphthalene-1,7-diol (PubChem CID 115010745) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 8-methyl-5,6,7,8-tetrahydronaphthalene-1,7-diol.
| Compound Name | 8-methyl-5,6,7,8-tetrahydronaphthalene-1,7-diol |
|---|---|
| PubChem CID | 115010745 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 8-methyl-5,6,7,8-tetrahydronaphthalene-1,7-diol |
| SMILES | CC1c2c(O)cccc2CCC1O |
| InChI | InChI=1S/C11H14O2/c1-7-9(12)6-5-8-3-2-4-10(13)11(7)8/h2-4,7,9,12-13H,5-6H2,1H3 |
| InChIKey | NDAFWSULRFYSIJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |