C11H13FO — CID 115010803
6-fluoro-1-methyl-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 115010803) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is 6-fluoro-1-methyl-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | 6-fluoro-1-methyl-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 115010803 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 6-fluoro-1-methyl-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | CC1c2ccc(F)cc2CCC1O |
| InChI | InChI=1S/C11H13FO/c1-7-10-4-3-9(12)6-8(10)2-5-11(7)13/h3-4,6-7,11,13H,2,5H2,1H3 |
| InChIKey | JSOKZCFHMPEQCX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |