C16H20FNO2 — CID 170661589
(1R,2R)-1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 170661589) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is (1R,2R)-1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (1R,2R)-1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 170661589 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (1R,2R)-1-[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-6-fluoro-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | O[C@@H]1CCc2cc(F)ccc2[C@H]1N1C[C@H]2COC[C@H]2C1 |
| InChI | InChI=1S/C16H20FNO2/c17-13-2-3-14-10(5-13)1-4-15(19)16(14)18-6-11-8-20-9-12(11)7-18/h2-3,5,11-12,15-16,19H,1,4,6-9H2/t11-,12+,15-,16-/m1/s1 |
| InChIKey | FSGRHZUVKYKXRY-NOXHYTERSA-N |
| XLogP | 1.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |