C16H21NO — CID 156837949
5-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 156837949) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 5-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 156837949 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 5-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | c1ccc2c(c1)CC[C@H](N1CC3COCC3C1)C2 |
| InChI | InChI=1S/C16H21NO/c1-2-4-13-7-16(6-5-12(13)3-1)17-8-14-10-18-11-15(14)9-17/h1-4,14-16H,5-11H2/t14?,15?,16-/m0/s1 |
| InChIKey | BAOLBSMQQNAQBI-GPANFISMSA-N |
| XLogP | 2.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |