C16H19F2NO — CID 156837799
(3aR,6aS)-5-[(2R)-4,4-difluoro-2,3-dihydro-1H-naphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 156837799) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2R)-4,4-difluoro-2,3-dihydro-1H-naphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-[(2R)-4,4-difluoro-2,3-dihydro-1H-naphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 156837799 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (3aR,6aS)-5-[(2R)-4,4-difluoro-2,3-dihydro-1H-naphthalen-2-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | FC1(F)C[C@H](N2C[C@H]3COC[C@H]3C2)Cc2ccccc21 |
| InChI | InChI=1S/C16H19F2NO/c17-16(18)6-14(5-11-3-1-2-4-15(11)16)19-7-12-9-20-10-13(12)8-19/h1-4,12-14H,5-10H2/t12-,13+,14-/m1/s1 |
| InChIKey | FYJLLAZPIMBDBP-HZSPNIEDSA-N |
| XLogP | 2.67 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |