C10H11NO2 — CID 123819052
spiro[1,2-dihydroindene-3,2'-1,3-dioxetane]-2-amine (PubChem CID 123819052) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,2'-1,3-dioxetane]-2-amine.
| Compound Name | spiro[1,2-dihydroindene-3,2'-1,3-dioxetane]-2-amine |
|---|---|
| PubChem CID | 123819052 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | spiro[1,2-dihydroindene-3,2'-1,3-dioxetane]-2-amine |
| SMILES | NC1Cc2ccccc2C12OCO2 |
| InChI | InChI=1S/C10H11NO2/c11-9-5-7-3-1-2-4-8(7)10(9)12-6-13-10/h1-4,9H,5-6,11H2 |
| InChIKey | MVLOXWNPQQMBTE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |