C14H19N — CID 22841653
(4aS,9aR)-4-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine (PubChem CID 22841653) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (4aS,9aR)-4-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine.
| Compound Name | (4aS,9aR)-4-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
|---|---|
| PubChem CID | 22841653 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (4aS,9aR)-4-methyl-1,2,3,4,9,9a-hexahydrofluoren-4a-amine |
| SMILES | CC1CCC[C@@H]2Cc3ccccc3[C@]12N |
| InChI | InChI=1S/C14H19N/c1-10-5-4-7-12-9-11-6-2-3-8-13(11)14(10,12)15/h2-3,6,8,10,12H,4-5,7,9,15H2,1H3/t10?,12-,14+/m1/s1 |
| InChIKey | SEIXOAIDAGGEFF-VOHIISRTSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |