C15H21N — CID 57431239
2-(1,2,3,4,9,9a-hexahydrofluoren-4a-yl)ethanamine (PubChem CID 57431239) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(1,2,3,4,9,9a-hexahydrofluoren-4a-yl)ethanamine.
| Compound Name | 2-(1,2,3,4,9,9a-hexahydrofluoren-4a-yl)ethanamine |
|---|---|
| PubChem CID | 57431239 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-(1,2,3,4,9,9a-hexahydrofluoren-4a-yl)ethanamine |
| SMILES | NCCC12CCCCC1Cc1ccccc12 |
| InChI | InChI=1S/C15H21N/c16-10-9-15-8-4-3-6-13(15)11-12-5-1-2-7-14(12)15/h1-2,5,7,13H,3-4,6,8-11,16H2 |
| InChIKey | JFGGCYPQBCUEMA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |