C17H24O — CID 82944714
(1-cyclohexyl-3,4-dihydro-2H-naphthalen-1-yl)methanol (PubChem CID 82944714) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (1-cyclohexyl-3,4-dihydro-2H-naphthalen-1-yl)methanol.
| Compound Name | (1-cyclohexyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 82944714 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (1-cyclohexyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
| SMILES | OCC1(C2CCCCC2)CCCc2ccccc21 |
| InChI | InChI=1S/C17H24O/c18-13-17(15-9-2-1-3-10-15)12-6-8-14-7-4-5-11-16(14)17/h4-5,7,11,15,18H,1-3,6,8-10,12-13H2 |
| InChIKey | DCCISUGVHXMACV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |