C13H18O — CID 66059601
(1-ethyl-3,4-dihydro-2H-naphthalen-1-yl)methanol (PubChem CID 66059601) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (1-ethyl-3,4-dihydro-2H-naphthalen-1-yl)methanol.
| Compound Name | (1-ethyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 66059601 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1-ethyl-3,4-dihydro-2H-naphthalen-1-yl)methanol |
| SMILES | CCC1(CO)CCCc2ccccc21 |
| InChI | InChI=1S/C13H18O/c1-2-13(10-14)9-5-7-11-6-3-4-8-12(11)13/h3-4,6,8,14H,2,5,7,9-10H2,1H3 |
| InChIKey | XYMMSMPZTUYOMR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |