C14H20 — CID 520431
4,4-diethyl-2,3-dihydro-1H-naphthalene (PubChem CID 520431) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 4,4-diethyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 4,4-diethyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 520431 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 4,4-diethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CCC1(CC)CCCc2ccccc21 |
| InChI | InChI=1S/C14H20/c1-3-14(4-2)11-7-9-12-8-5-6-10-13(12)14/h5-6,8,10H,3-4,7,9,11H2,1-2H3 |
| InChIKey | DBFQMDNLSBZPMF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |