C16H25NO — CID 163377790
ethane;2-[1-(methylaminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetaldehyde (PubChem CID 163377790) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;2-[1-(methylaminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetaldehyde.
| Compound Name | ethane;2-[1-(methylaminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 163377790 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;2-[1-(methylaminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetaldehyde |
| SMILES | CC.CNCC1(CC=O)CCCc2ccccc21 |
| InChI | InChI=1S/C14H19NO.C2H6/c1-15-11-14(9-10-16)8-4-6-12-5-2-3-7-13(12)14;1-2/h2-3,5,7,10,15H,4,6,8-9,11H2,1H3;1-2H3 |
| InChIKey | GWJNUQJJWVYFAS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|