C15H23ClSi — CID 106324106
[1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl-trimethylsilane (PubChem CID 106324106) has the molecular formula C15H23ClSi and a molecular weight of 266.89 g/mol. Its IUPAC name is [1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl-trimethylsilane.
| Compound Name | [1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 106324106 |
| Molecular Formula | C15H23ClSi |
| Molecular Weight | 266.89 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [1-(chloromethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl-trimethylsilane |
| SMILES | C[Si](C)(C)CC1(CCl)CCCc2ccccc21 |
| InChI | InChI=1S/C15H23ClSi/c1-17(2,3)12-15(11-16)10-6-8-13-7-4-5-9-14(13)15/h4-5,7,9H,6,8,10-12H2,1-3H3 |
| InChIKey | YFMFRJDYLZEXKS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|