C16H23ClO2S — CID 106734497
4-(chloromethyl)-4-(2-propylsulfonylethyl)-2,3-dihydro-1H-naphthalene (PubChem CID 106734497) has the molecular formula C16H23ClO2S and a molecular weight of 314.88 g/mol. Its IUPAC name is 4-(chloromethyl)-4-(2-propylsulfonylethyl)-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(chloromethyl)-4-(2-propylsulfonylethyl)-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 106734497 |
| Molecular Formula | C16H23ClO2S |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-(chloromethyl)-4-(2-propylsulfonylethyl)-2,3-dihydro-1H-naphthalene |
| SMILES | CCCS(=O)(=O)CCC1(CCl)CCCc2ccccc21 |
| InChI | InChI=1S/C16H23ClO2S/c1-2-11-20(18,19)12-10-16(13-17)9-5-7-14-6-3-4-8-15(14)16/h3-4,6,8H,2,5,7,9-13H2,1H3 |
| InChIKey | NWLFFTFRDKKOPO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|