C20H31Br — CID 66047893
4-(bromomethyl)-4-nonyl-2,3-dihydro-1H-naphthalene (PubChem CID 66047893) has the molecular formula C20H31Br and a molecular weight of 351.37 g/mol. Its IUPAC name is 4-(bromomethyl)-4-nonyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(bromomethyl)-4-nonyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 66047893 |
| Molecular Formula | C20H31Br |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-(bromomethyl)-4-nonyl-2,3-dihydro-1H-naphthalene |
| SMILES | CCCCCCCCCC1(CBr)CCCc2ccccc21 |
| InChI | InChI=1S/C20H31Br/c1-2-3-4-5-6-7-10-15-20(17-21)16-11-13-18-12-8-9-14-19(18)20/h8-9,12,14H,2-7,10-11,13,15-17H2,1H3 |
| InChIKey | INXLEODJTMIYNG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|