C17H25BrO2 — CID 103415407
4-(bromomethyl)-4-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-naphthalene (PubChem CID 103415407) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 4-(bromomethyl)-4-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(bromomethyl)-4-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 103415407 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 4-(bromomethyl)-4-[3-(2-methoxyethoxy)propyl]-2,3-dihydro-1H-naphthalene |
| SMILES | COCCOCCCC1(CBr)CCCc2ccccc21 |
| InChI | InChI=1S/C17H25BrO2/c1-19-12-13-20-11-5-10-17(14-18)9-4-7-15-6-2-3-8-16(15)17/h2-3,6,8H,4-5,7,9-14H2,1H3 |
| InChIKey | QGFJKPSZNNFYRL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|