C16H21NO2 — CID 103415058
1-[3-(2-methoxyethoxy)propyl]-2,3-dihydroindene-1-carbonitrile (PubChem CID 103415058) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-[3-(2-methoxyethoxy)propyl]-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 1-[3-(2-methoxyethoxy)propyl]-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 103415058 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 1-[3-(2-methoxyethoxy)propyl]-2,3-dihydroindene-1-carbonitrile |
| SMILES | COCCOCCCC1(C#N)CCc2ccccc21 |
| InChI | InChI=1S/C16H21NO2/c1-18-11-12-19-10-4-8-16(13-17)9-7-14-5-2-3-6-15(14)16/h2-3,5-6H,4,7-12H2,1H3 |
| InChIKey | YPXUCPQEOHIWOF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|