C19H27N — CID 65376390
1-octyl-3,4-dihydro-2H-naphthalene-1-carbonitrile (PubChem CID 65376390) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-octyl-3,4-dihydro-2H-naphthalene-1-carbonitrile.
| Compound Name | 1-octyl-3,4-dihydro-2H-naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 65376390 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-octyl-3,4-dihydro-2H-naphthalene-1-carbonitrile |
| SMILES | CCCCCCCCC1(C#N)CCCc2ccccc21 |
| InChI | InChI=1S/C19H27N/c1-2-3-4-5-6-9-14-19(16-20)15-10-12-17-11-7-8-13-18(17)19/h7-8,11,13H,2-6,9-10,12,14-15H2,1H3 |
| InChIKey | CPBLTLDLLJJGOI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|