C15H18FN — CID 114280383
1-(5-fluoropentyl)-2,3-dihydroindene-1-carbonitrile (PubChem CID 114280383) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is 1-(5-fluoropentyl)-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 1-(5-fluoropentyl)-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 114280383 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 1-(5-fluoropentyl)-2,3-dihydroindene-1-carbonitrile |
| SMILES | N#CC1(CCCCCF)CCc2ccccc21 |
| InChI | InChI=1S/C15H18FN/c16-11-5-1-4-9-15(12-17)10-8-13-6-2-3-7-14(13)15/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | COVXWLYUNNONAJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|