C12H10N2 — CID 6925451
(1S)-1-(cyanomethyl)-2,3-dihydroindene-1-carbonitrile (PubChem CID 6925451) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is (1S)-1-(cyanomethyl)-2,3-dihydroindene-1-carbonitrile.
| Compound Name | (1S)-1-(cyanomethyl)-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 6925451 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (1S)-1-(cyanomethyl)-2,3-dihydroindene-1-carbonitrile |
| SMILES | N#CC[C@@]1(C#N)CCc2ccccc21 |
| InChI | InChI=1S/C12H10N2/c13-8-7-12(9-14)6-5-10-3-1-2-4-11(10)12/h1-4H,5-7H2/t12-/m1/s1 |
| InChIKey | QDXWDVPSKWHIDI-GFCCVEGCSA-N |
| XLogP | 2.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |