C18H27Br — CID 66047892
4-(bromomethyl)-4-heptyl-2,3-dihydro-1H-naphthalene (PubChem CID 66047892) has the molecular formula C18H27Br and a molecular weight of 323.32 g/mol. Its IUPAC name is 4-(bromomethyl)-4-heptyl-2,3-dihydro-1H-naphthalene.
| Compound Name | 4-(bromomethyl)-4-heptyl-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 66047892 |
| Molecular Formula | C18H27Br |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-(bromomethyl)-4-heptyl-2,3-dihydro-1H-naphthalene |
| SMILES | CCCCCCCC1(CBr)CCCc2ccccc21 |
| InChI | InChI=1S/C18H27Br/c1-2-3-4-5-8-13-18(15-19)14-9-11-16-10-6-7-12-17(16)18/h6-7,10,12H,2-5,8-9,11,13-15H2,1H3 |
| InChIKey | PEQZHSILIWLDAK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|