C18H28O — CID 65147147
5-heptyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol (PubChem CID 65147147) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is 5-heptyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol.
| Compound Name | 5-heptyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 65147147 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 5-heptyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
| SMILES | CCCCCCCC1(O)CCCCc2ccccc21 |
| InChI | InChI=1S/C18H28O/c1-2-3-4-5-9-14-18(19)15-10-8-12-16-11-6-7-13-17(16)18/h6-7,11,13,19H,2-5,8-10,12,14-15H2,1H3 |
| InChIKey | VHIPIYFMXLCNMH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|