About 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol
2-heptyl-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 65147056) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 65147056 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CCCCCCCC1(O)CCc2ccccc2C1 |
| InChI | InChI=1S/C17H26O/c1-2-3-4-5-8-12-17(18)13-11-15-9-6-7-10-16(15)14-17/h6-7,9-10,18H,2-5,8,11-14H2,1H3 |
| InChIKey | MLRGCOBGVXIRBA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol (CID 65147056) is 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol is CCCCCCCC1(O)CCc2ccccc2C1.
What is the InChIKey of 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol?
The InChIKey is MLRGCOBGVXIRBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-2-3-4-5-8-12-17(18)13-11-15-9-6-7-10-16(15)14-17/h6-7,9-10,18H,2-5,8,11-14H2,1H3.
What are the key properties of 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol?
2-heptyl-3,4-dihydro-1H-naphthalen-2-ol has a molecular weight of 246.39 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-3,4-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 65147056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).