About 1-heptylcycloheptan-1-ol
1-heptylcycloheptan-1-ol (PubChem CID 57057960) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-heptylcycloheptan-1-ol.
Molecular Properties
| Compound Name | 1-heptylcycloheptan-1-ol |
| PubChem CID | 57057960 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | 1-heptylcycloheptan-1-ol |
| SMILES | CCCCCCCC1(O)CCCCCC1 |
| InChI | InChI=1S/C14H28O/c1-2-3-4-5-8-11-14(15)12-9-6-7-10-13-14/h15H,2-13H2,1H3 |
| InChIKey | DRGQYLYHSHCWNF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-heptylcycloheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptylcycloheptan-1-ol?
The IUPAC name of 1-heptylcycloheptan-1-ol (CID 57057960) is 1-heptylcycloheptan-1-ol.
What is the SMILES notation for 1-heptylcycloheptan-1-ol?
The canonical SMILES for 1-heptylcycloheptan-1-ol is CCCCCCCC1(O)CCCCCC1.
What is the InChIKey of 1-heptylcycloheptan-1-ol?
The InChIKey is DRGQYLYHSHCWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O/c1-2-3-4-5-8-11-14(15)12-9-6-7-10-13-14/h15H,2-13H2,1H3.
What are the key properties of 1-heptylcycloheptan-1-ol?
1-heptylcycloheptan-1-ol has a molecular weight of 212.38 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptylcycloheptan-1-ol is sourced from PubChem (CID 57057960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).