About 4-pentyloxan-4-ol
4-pentyloxan-4-ol (PubChem CID 65145510) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 4-pentyloxan-4-ol.
Molecular Properties
| Compound Name | 4-pentyloxan-4-ol |
| PubChem CID | 65145510 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 4-pentyloxan-4-ol |
| SMILES | CCCCCC1(O)CCOCC1 |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-5-10(11)6-8-12-9-7-10/h11H,2-9H2,1H3 |
| InChIKey | NCRAARPAPMEOFK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pentyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pentyloxan-4-ol?
The IUPAC name of 4-pentyloxan-4-ol (CID 65145510) is 4-pentyloxan-4-ol.
What is the SMILES notation for 4-pentyloxan-4-ol?
The canonical SMILES for 4-pentyloxan-4-ol is CCCCCC1(O)CCOCC1.
What is the InChIKey of 4-pentyloxan-4-ol?
The InChIKey is NCRAARPAPMEOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-2-3-4-5-10(11)6-8-12-9-7-10/h11H,2-9H2,1H3.
What are the key properties of 4-pentyloxan-4-ol?
4-pentyloxan-4-ol has a molecular weight of 172.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pentyloxan-4-ol is sourced from PubChem (CID 65145510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).