About 4-heptyloxan-4-amine
4-heptyloxan-4-amine (PubChem CID 63220508) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 4-heptyloxan-4-amine.
Molecular Properties
| Compound Name | 4-heptyloxan-4-amine |
| PubChem CID | 63220508 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 4-heptyloxan-4-amine |
| SMILES | CCCCCCCC1(N)CCOCC1 |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-12(13)8-10-14-11-9-12/h2-11,13H2,1H3 |
| InChIKey | QHGFEXKAHZXKAQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptyloxan-4-amine?
The IUPAC name of 4-heptyloxan-4-amine (CID 63220508) is 4-heptyloxan-4-amine.
What is the SMILES notation for 4-heptyloxan-4-amine?
The canonical SMILES for 4-heptyloxan-4-amine is CCCCCCCC1(N)CCOCC1.
What is the InChIKey of 4-heptyloxan-4-amine?
The InChIKey is QHGFEXKAHZXKAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-2-3-4-5-6-7-12(13)8-10-14-11-9-12/h2-11,13H2,1H3.
What are the key properties of 4-heptyloxan-4-amine?
4-heptyloxan-4-amine has a molecular weight of 199.34 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptyloxan-4-amine is sourced from PubChem (CID 63220508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).