C20H33N — CID 65408872
(2-nonyl-3,4-dihydro-1H-naphthalen-2-yl)methanamine (PubChem CID 65408872) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (2-nonyl-3,4-dihydro-1H-naphthalen-2-yl)methanamine.
| Compound Name | (2-nonyl-3,4-dihydro-1H-naphthalen-2-yl)methanamine |
|---|---|
| PubChem CID | 65408872 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (2-nonyl-3,4-dihydro-1H-naphthalen-2-yl)methanamine |
| SMILES | CCCCCCCCCC1(CN)CCc2ccccc2C1 |
| InChI | InChI=1S/C20H33N/c1-2-3-4-5-6-7-10-14-20(17-21)15-13-18-11-8-9-12-19(18)16-20/h8-9,11-12H,2-7,10,13-17,21H2,1H3 |
| InChIKey | AIDOZRYYWSJZHK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|