C15H18O — CID 63656307
5-but-3-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol (PubChem CID 63656307) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 5-but-3-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol.
| Compound Name | 5-but-3-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 63656307 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 5-but-3-ynyl-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
| SMILES | C#CCCC1(O)CCCCc2ccccc21 |
| InChI | InChI=1S/C15H18O/c1-2-3-11-15(16)12-7-6-9-13-8-4-5-10-14(13)15/h1,4-5,8,10,16H,3,6-7,9,11-12H2 |
| InChIKey | CCVTYGQHCMVOSH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|