C18H31NSi — CID 106323563
N-[[1-(trimethylsilylmethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]propan-2-amine (PubChem CID 106323563) has the molecular formula C18H31NSi and a molecular weight of 289.54 g/mol. Its IUPAC name is N-[[1-(trimethylsilylmethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-(trimethylsilylmethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106323563 |
| Molecular Formula | C18H31NSi |
| Molecular Weight | 289.54 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[[1-(trimethylsilylmethyl)-3,4-dihydro-2H-naphthalen-1-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(C[Si](C)(C)C)CCCc2ccccc21 |
| InChI | InChI=1S/C18H31NSi/c1-15(2)19-13-18(14-20(3,4)5)12-8-10-16-9-6-7-11-17(16)18/h6-7,9,11,15,19H,8,10,12-14H2,1-5H3 |
| InChIKey | DADIBCLECBUTMP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|