C16H23N — CID 82933231
(1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)methanamine (PubChem CID 82933231) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)methanamine.
| Compound Name | (1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)methanamine |
|---|---|
| PubChem CID | 82933231 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (1-cyclopentyl-3,4-dihydro-2H-naphthalen-1-yl)methanamine |
| SMILES | NCC1(C2CCCC2)CCCc2ccccc21 |
| InChI | InChI=1S/C16H23N/c17-12-16(14-8-2-3-9-14)11-5-7-13-6-1-4-10-15(13)16/h1,4,6,10,14H,2-3,5,7-9,11-12,17H2 |
| InChIKey | MCRLHBNOOHDLCO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |