About 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol
3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 57031707) has the molecular formula C10H12ClNO
and a molecular weight of 197.67 g/mol. Its IUPAC name is 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol.
Molecular Properties
| Compound Name | 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol |
| PubChem CID | 57031707 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | NC1Cc2ccccc2C(O)(Cl)C1 |
| InChI | InChI=1S/C10H12ClNO/c11-10(13)6-8(12)5-7-3-1-2-4-9(7)10/h1-4,8,13H,5-6,12H2 |
| InChIKey | QXOVOSZGTYVIIS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol?
The IUPAC name of 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol (CID 57031707) is 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol.
What is the SMILES notation for 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol?
The canonical SMILES for 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol is NC1Cc2ccccc2C(O)(Cl)C1.
What is the InChIKey of 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol?
The InChIKey is QXOVOSZGTYVIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO/c11-10(13)6-8(12)5-7-3-1-2-4-9(7)10/h1-4,8,13H,5-6,12H2.
What are the key properties of 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol?
3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol has a molecular weight of 197.67 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-chloro-3,4-dihydro-2H-naphthalen-1-ol is sourced from PubChem (CID 57031707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).