C16H22N2 — CID 67127311
(1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-amine (PubChem CID 67127311) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-amine.
| Compound Name | (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-amine |
|---|---|
| PubChem CID | 67127311 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (1S,9R,10R,13R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-amine |
| SMILES | N[C@@H]1CC[C@H]2[C@H]3Cc4ccccc4[C@@]2(CCN3)C1 |
| InChI | InChI=1S/C16H22N2/c17-12-5-6-14-15-9-11-3-1-2-4-13(11)16(14,10-12)7-8-18-15/h1-4,12,14-15,18H,5-10,17H2/t12-,14+,15-,16-/m1/s1 |
| InChIKey | ITJUMAAPIQSIHR-SLBVQIDZSA-N |
| XLogP | 1.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |