C17H21NO — CID 54005917
(1S,9R,10R,12S)-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one (PubChem CID 54005917) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (1S,9R,10R,12S)-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one.
| Compound Name | (1S,9R,10R,12S)-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
|---|---|
| PubChem CID | 54005917 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (1S,9R,10R,12S)-12-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-13-one |
| SMILES | C[C@H]1C[C@H]2[C@H]3Cc4ccccc4[C@@]2(CCN3)CC1=O |
| InChI | InChI=1S/C17H21NO/c1-11-8-14-15-9-12-4-2-3-5-13(12)17(14,6-7-18-15)10-16(11)19/h2-5,11,14-15,18H,6-10H2,1H3/t11-,14-,15+,17+/m0/s1 |
| InChIKey | KOWKYHVVFKUDLI-ZYIUAKIQSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |