C19H26N2O — CID 157253048
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;prop-2-enamide (PubChem CID 157253048) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;prop-2-enamide.
| Compound Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;prop-2-enamide |
|---|---|
| PubChem CID | 157253048 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;prop-2-enamide |
| SMILES | C=CC(N)=O.c1ccc2c(c1)C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C16H21N.C3H5NO/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15;1-2-3(4)5/h1-2,5-6,14-15,17H,3-4,7-11H2;2H,1H2,(H2,4,5)/t14-,15+,16-;/m0./s1 |
| InChIKey | AWOFPPRHBMYSEF-CLUYDPBTSA-N |
| XLogP | 2.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|