C24H27NO — CID 69251527
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;1-benzofuran (PubChem CID 69251527) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;1-benzofuran.
| Compound Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;1-benzofuran |
|---|---|
| PubChem CID | 69251527 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;1-benzofuran |
| SMILES | c1ccc2c(c1)C[C@H]1NCC[C@@]23CCCC[C@@H]13.c1ccc2occc2c1 |
| InChI | InChI=1S/C16H21N.C8H6O/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15;1-2-4-8-7(3-1)5-6-9-8/h1-2,5-6,14-15,17H,3-4,7-11H2;1-6H/t14-,15+,16-;/m0./s1 |
| InChIKey | AIZCXLRRLVCZIW-CLUYDPBTSA-N |
| XLogP | 5.47 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |