C16H24ClNO — CID 141299651
(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;hydrate;hydrochloride (PubChem CID 141299651) has the molecular formula C16H24ClNO and a molecular weight of 281.83 g/mol. Its IUPAC name is (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;hydrate;hydrochloride.
| Compound Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;hydrate;hydrochloride |
|---|---|
| PubChem CID | 141299651 |
| Molecular Formula | C16H24ClNO |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene;hydrate;hydrochloride |
| SMILES | Cl.O.c1ccc2c(c1)C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C16H21N.ClH.H2O/c1-2-6-13-12(5-1)11-15-14-7-3-4-8-16(13,14)9-10-17-15;;/h1-2,5-6,14-15,17H,3-4,7-11H2;1H;1H2/t14-,15+,16-;;/m0../s1 |
| InChIKey | HCJVVZGGQBGGFH-GHDHQEDTSA-N |
| XLogP | 2.63 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |