C23H28N2 — CID 123485564
(1R,9R,10R)-N-benzyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 123485564) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (1R,9R,10R)-N-benzyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-N-benzyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 123485564 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | (1R,9R,10R)-N-benzyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | c1ccc(CNc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)NCC4)cc1 |
| InChI | InChI=1S/C23H28N2/c1-2-6-17(7-3-1)16-25-19-10-9-18-14-22-20-8-4-5-11-23(20,12-13-24-22)21(18)15-19/h1-3,6-7,9-10,15,20,22,24-25H,4-5,8,11-14,16H2/t20-,22+,23+/m0/s1 |
| InChIKey | UNDPIGNTVQALGR-MDNUFGMLSA-N |
| XLogP | 4.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |