C28H35IN2 — CID 44627786
(1R,9R,10R)-17-(cyclobutylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine (PubChem CID 44627786) has the molecular formula C28H35IN2 and a molecular weight of 526.51 g/mol. Its IUPAC name is (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine.
| Compound Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 44627786 |
| Molecular Formula | C28H35IN2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (1R,9R,10R)-17-(cyclobutylmethyl)-N-[(4-iodophenyl)methyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-amine |
| SMILES | Ic1ccc(CNc2ccc3c(c2)[C@@]24CCCC[C@H]2[C@@H](C3)N(CC2CCC2)CC4)cc1 |
| InChI | InChI=1S/C28H35IN2/c29-23-10-7-20(8-11-23)18-30-24-12-9-22-16-27-25-6-1-2-13-28(25,26(22)17-24)14-15-31(27)19-21-4-3-5-21/h7-12,17,21,25,27,30H,1-6,13-16,18-19H2/t25-,27+,28+/m0/s1 |
| InChIKey | ANRBPZIHUJJUFY-KJYTXNCISA-N |
| XLogP | 6.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|