C27H36Cl2N2O — CID 57413480
2-[[[(1R,9R,10R)-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]amino]methyl]phenol;dihydrochloride (PubChem CID 57413480) has the molecular formula C27H36Cl2N2O and a molecular weight of 475.50 g/mol. Its IUPAC name is 2-[[[(1R,9R,10R)-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]amino]methyl]phenol;dihydrochloride.
| Compound Name | 2-[[[(1R,9R,10R)-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]amino]methyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 57413480 |
| Molecular Formula | C27H36Cl2N2O |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-[[[(1R,9R,10R)-17-(cyclopropylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]amino]methyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccccc1CNc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CC1)CC3 |
| InChI | InChI=1S/C27H34N2O.2ClH/c30-26-7-2-1-5-21(26)17-28-22-11-10-20-15-25-23-6-3-4-12-27(23,24(20)16-22)13-14-29(25)18-19-8-9-19;;/h1-2,5,7,10-11,16,19,23,25,28,30H,3-4,6,8-9,12-15,17-18H2;2*1H/t23-,25+,27+;;/m0../s1 |
| InChIKey | KKTWUTMCKVGNGH-GZXNQZDMSA-N |
| XLogP | 6.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|