C29H38N2O — CID 57412343
4-[[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-methylamino]methyl]phenol (PubChem CID 57412343) has the molecular formula C29H38N2O and a molecular weight of 430.64 g/mol. Its IUPAC name is 4-[[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-methylamino]methyl]phenol.
| Compound Name | 4-[[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 57412343 |
| Molecular Formula | C29H38N2O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 4-[[[(1R,9R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]-methylamino]methyl]phenol |
| SMILES | CN(Cc1ccc(O)cc1)c1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C29H38N2O/c1-30(19-22-8-12-25(32)13-9-22)24-11-10-23-17-28-26-7-2-3-14-29(26,27(23)18-24)15-16-31(28)20-21-5-4-6-21/h8-13,18,21,26,28,32H,2-7,14-17,19-20H2,1H3/t26-,28+,29+/m0/s1 |
| InChIKey | STDNQQBEKZLXJQ-WIIGKZCBSA-N |
| XLogP | 5.89 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |