C22H30N2O — CID 10427272
(1R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide (PubChem CID 10427272) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is (1R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 10427272 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | (1R,10R)-17-(cyclobutylmethyl)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)[C@@]13CCCC[C@H]1C(C2)N(CC1CCC1)CC3 |
| InChI | InChI=1S/C22H30N2O/c23-21(25)17-8-7-16-13-20-18-6-1-2-9-22(18,19(16)12-17)10-11-24(20)14-15-4-3-5-15/h7-8,12,15,18,20H,1-6,9-11,13-14H2,(H2,23,25)/t18-,20?,22+/m0/s1 |
| InChIKey | GIZYPGRXWUVSHP-VRTQEHCBSA-N |
| XLogP | 3.64 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |