C22H32N2O — CID 146226382
3-[(1R,4aR,8aR)-2-(cyclopropylmethyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]-4-methylbenzamide (PubChem CID 146226382) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 3-[(1R,4aR,8aR)-2-(cyclopropylmethyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]-4-methylbenzamide.
| Compound Name | 3-[(1R,4aR,8aR)-2-(cyclopropylmethyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 146226382 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 3-[(1R,4aR,8aR)-2-(cyclopropylmethyl)-1-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1[C@@]12CCCC[C@H]1[C@@H](C)N(CC1CC1)CC2 |
| InChI | InChI=1S/C22H32N2O/c1-15-6-9-18(21(23)25)13-20(15)22-10-4-3-5-19(22)16(2)24(12-11-22)14-17-7-8-17/h6,9,13,16-17,19H,3-5,7-8,10-12,14H2,1-2H3,(H2,23,25)/t16-,19+,22-/m1/s1 |
| InChIKey | CGLJJFQBQZTRAU-GTCCEBARSA-N |
| XLogP | 4.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |