C23H35N3O — CID 126490351
[2-(cyclopropylmethyl)-1-methyl-4a-(2-methylphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]methylurea (PubChem CID 126490351) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is [2-(cyclopropylmethyl)-1-methyl-4a-(2-methylphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]methylurea.
| Compound Name | [2-(cyclopropylmethyl)-1-methyl-4a-(2-methylphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]methylurea |
|---|---|
| PubChem CID | 126490351 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | [2-(cyclopropylmethyl)-1-methyl-4a-(2-methylphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]methylurea |
| SMILES | Cc1ccccc1C12CCN(CC3CC3)C(C)C1CCC(CNC(N)=O)C2 |
| InChI | InChI=1S/C23H35N3O/c1-16-5-3-4-6-20(16)23-11-12-26(15-18-7-8-18)17(2)21(23)10-9-19(13-23)14-25-22(24)27/h3-6,17-19,21H,7-15H2,1-2H3,(H3,24,25,27) |
| InChIKey | AHKDNYQFLSYYLM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |